C11H13F4NO3 — CID 15767482
5-[2-[2-(difluoromethoxy)ethoxy]ethoxy]-2,4-difluoroaniline (PubChem CID 15767482) has the molecular formula C11H13F4NO3 and a molecular weight of 283.22 g/mol. Its IUPAC name is 5-[2-[2-(difluoromethoxy)ethoxy]ethoxy]-2,4-difluoroaniline.
| Compound Name | 5-[2-[2-(difluoromethoxy)ethoxy]ethoxy]-2,4-difluoroaniline |
|---|---|
| PubChem CID | 15767482 |
| Molecular Formula | C11H13F4NO3 |
| Molecular Weight | 283.22 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 5-[2-[2-(difluoromethoxy)ethoxy]ethoxy]-2,4-difluoroaniline |
| SMILES | Nc1cc(OCCOCCOC(F)F)c(F)cc1F |
| InChI | InChI=1S/C11H13F4NO3/c12-7-5-8(13)10(6-9(7)16)18-3-1-17-2-4-19-11(14)15/h5-6,11H,1-4,16H2 |
| InChIKey | BZLOMVJJRSIQLB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.22 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|