C11H15F2NO2 — CID 63597424
5-(4-amino-2,5-difluorophenoxy)pentan-1-ol (PubChem CID 63597424) has the molecular formula C11H15F2NO2 and a molecular weight of 231.24 g/mol. Its IUPAC name is 5-(4-amino-2,5-difluorophenoxy)pentan-1-ol.
| Compound Name | 5-(4-amino-2,5-difluorophenoxy)pentan-1-ol |
|---|---|
| PubChem CID | 63597424 |
| Molecular Formula | C11H15F2NO2 |
| Molecular Weight | 231.24 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 5-(4-amino-2,5-difluorophenoxy)pentan-1-ol |
| SMILES | Nc1cc(F)c(OCCCCCO)cc1F |
| InChI | InChI=1S/C11H15F2NO2/c12-8-7-11(9(13)6-10(8)14)16-5-3-1-2-4-15/h6-7,15H,1-5,14H2 |
| InChIKey | OWSGKPRPZZHBKV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|