C9H9F2NO3 — CID 63947858
3-(4-amino-2,5-difluorophenoxy)propanoic acid (PubChem CID 63947858) has the molecular formula C9H9F2NO3 and a molecular weight of 217.17 g/mol. Its IUPAC name is 3-(4-amino-2,5-difluorophenoxy)propanoic acid.
| Compound Name | 3-(4-amino-2,5-difluorophenoxy)propanoic acid |
|---|---|
| PubChem CID | 63947858 |
| Molecular Formula | C9H9F2NO3 |
| Molecular Weight | 217.17 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 3-(4-amino-2,5-difluorophenoxy)propanoic acid |
| SMILES | Nc1cc(F)c(OCCC(=O)O)cc1F |
| InChI | InChI=1S/C9H9F2NO3/c10-5-4-8(6(11)3-7(5)12)15-2-1-9(13)14/h3-4H,1-2,12H2,(H,13,14) |
| InChIKey | TVTHXZYVQJJUII-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.17 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|