C10H13F2NO2 — CID 63599718
4-(4-amino-2,5-difluorophenoxy)butan-1-ol (PubChem CID 63599718) has the molecular formula C10H13F2NO2 and a molecular weight of 217.21 g/mol. Its IUPAC name is 4-(4-amino-2,5-difluorophenoxy)butan-1-ol.
| Compound Name | 4-(4-amino-2,5-difluorophenoxy)butan-1-ol |
|---|---|
| PubChem CID | 63599718 |
| Molecular Formula | C10H13F2NO2 |
| Molecular Weight | 217.21 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 4-(4-amino-2,5-difluorophenoxy)butan-1-ol |
| SMILES | Nc1cc(F)c(OCCCCO)cc1F |
| InChI | InChI=1S/C10H13F2NO2/c11-7-6-10(8(12)5-9(7)13)15-4-2-1-3-14/h5-6,14H,1-4,13H2 |
| InChIKey | TUPZTOXYIYLSPY-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.21 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|