C12H17F2NOS — CID 114271242
4-(2-tert-butylsulfanylethoxy)-2,5-difluoroaniline (PubChem CID 114271242) has the molecular formula C12H17F2NOS and a molecular weight of 261.34 g/mol. Its IUPAC name is 4-(2-tert-butylsulfanylethoxy)-2,5-difluoroaniline.
| Compound Name | 4-(2-tert-butylsulfanylethoxy)-2,5-difluoroaniline |
|---|---|
| PubChem CID | 114271242 |
| Molecular Formula | C12H17F2NOS |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 4-(2-tert-butylsulfanylethoxy)-2,5-difluoroaniline |
| SMILES | CC(C)(C)SCCOc1cc(F)c(N)cc1F |
| InChI | InChI=1S/C12H17F2NOS/c1-12(2,3)17-5-4-16-11-7-8(13)10(15)6-9(11)14/h6-7H,4-5,15H2,1-3H3 |
| InChIKey | SPDLENRGSKRHIN-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|