C13H20FNO2 — CID 107259923
4-(3,3-dimethylbutoxy)-5-fluoro-2-methoxyaniline (PubChem CID 107259923) has the molecular formula C13H20FNO2 and a molecular weight of 241.31 g/mol. Its IUPAC name is 4-(3,3-dimethylbutoxy)-5-fluoro-2-methoxyaniline.
| Compound Name | 4-(3,3-dimethylbutoxy)-5-fluoro-2-methoxyaniline |
|---|---|
| PubChem CID | 107259923 |
| Molecular Formula | C13H20FNO2 |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 4-(3,3-dimethylbutoxy)-5-fluoro-2-methoxyaniline |
| SMILES | COc1cc(OCCC(C)(C)C)c(F)cc1N |
| InChI | InChI=1S/C13H20FNO2/c1-13(2,3)5-6-17-11-8-12(16-4)10(15)7-9(11)14/h7-8H,5-6,15H2,1-4H3 |
| InChIKey | FZXGRMXJKQKHSH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|