C23H32F2O — CID 134358461
1-[(E)-but-2-enoxy]-2,3-difluoro-4-[4-(4-methylcyclohexyl)cyclohexyl]benzene (PubChem CID 134358461) has the molecular formula C23H32F2O and a molecular weight of 362.50 g/mol. Its IUPAC name is 1-[(E)-but-2-enoxy]-2,3-difluoro-4-[4-(4-methylcyclohexyl)cyclohexyl]benzene.
| Compound Name | 1-[(E)-but-2-enoxy]-2,3-difluoro-4-[4-(4-methylcyclohexyl)cyclohexyl]benzene |
|---|---|
| PubChem CID | 134358461 |
| Molecular Formula | C23H32F2O |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | 1-[(E)-but-2-enoxy]-2,3-difluoro-4-[4-(4-methylcyclohexyl)cyclohexyl]benzene |
| SMILES | C/C=C/COc1ccc(C2CCC(C3CCC(C)CC3)CC2)c(F)c1F |
| InChI | InChI=1S/C23H32F2O/c1-3-4-15-26-21-14-13-20(22(24)23(21)25)19-11-9-18(10-12-19)17-7-5-16(2)6-8-17/h3-4,13-14,16-19H,5-12,15H2,1-2H3/b4-3+ |
| InChIKey | KQYKANALVDVXNT-ONEGZZNKSA-N |
| XLogP | 7.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|