C40H36F6O4 — CID 134277442
4-[2-[4-[9-[4-[2-(4-ethoxy-2,3-difluorophenyl)ethynyl]-3-fluorophenoxy]-5-methylnonoxy]-2-fluorophenyl]ethynyl]-2,3-difluorophenol (PubChem CID 134277442) has the molecular formula C40H36F6O4 and a molecular weight of 694.71 g/mol. Its IUPAC name is 4-[2-[4-[9-[4-[2-(4-ethoxy-2,3-difluorophenyl)ethynyl]-3-fluorophenoxy]-5-methylnonoxy]-2-fluorophenyl]ethynyl]-2,3-difluorophenol.
| Compound Name | 4-[2-[4-[9-[4-[2-(4-ethoxy-2,3-difluorophenyl)ethynyl]-3-fluorophenoxy]-5-methylnonoxy]-2-fluorophenyl]ethynyl]-2,3-difluorophenol |
|---|---|
| PubChem CID | 134277442 |
| Molecular Formula | C40H36F6O4 |
| Molecular Weight | 694.71 g/mol |
| Exact Mass | 694.25 |
| IUPAC Name | 4-[2-[4-[9-[4-[2-(4-ethoxy-2,3-difluorophenyl)ethynyl]-3-fluorophenoxy]-5-methylnonoxy]-2-fluorophenyl]ethynyl]-2,3-difluorophenol |
| SMILES | CCOc1ccc(C#Cc2ccc(OCCCCC(C)CCCCOc3ccc(C#Cc4ccc(O)c(F)c4F)c(F)c3)cc2F)c(F)c1F |
| InChI | InChI=1S/C40H36F6O4/c1-3-48-36-21-17-30(38(44)40(36)46)13-11-28-15-19-32(25-34(28)42)50-23-7-5-9-26(2)8-4-6-22-49-31-18-14-27(33(41)24-31)10-12-29-16-20-35(47)39(45)37(29)43/h14-21,24-26,47H,3-9,22-23H2,1-2H3 |
| InChIKey | GLHLVVCDKKUHOV-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.71 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|