C40H38F4O2 — CID 122542725
2-fluoro-4-[11-[3-fluoro-4-[2-(4-fluorophenyl)ethynyl]phenoxy]-6-methylundecoxy]-1-[2-(4-fluorophenyl)ethynyl]benzene (PubChem CID 122542725) has the molecular formula C40H38F4O2 and a molecular weight of 626.73 g/mol. Its IUPAC name is 2-fluoro-4-[11-[3-fluoro-4-[2-(4-fluorophenyl)ethynyl]phenoxy]-6-methylundecoxy]-1-[2-(4-fluorophenyl)ethynyl]benzene.
| Compound Name | 2-fluoro-4-[11-[3-fluoro-4-[2-(4-fluorophenyl)ethynyl]phenoxy]-6-methylundecoxy]-1-[2-(4-fluorophenyl)ethynyl]benzene |
|---|---|
| PubChem CID | 122542725 |
| Molecular Formula | C40H38F4O2 |
| Molecular Weight | 626.73 g/mol |
| Exact Mass | 626.28 |
| IUPAC Name | 2-fluoro-4-[11-[3-fluoro-4-[2-(4-fluorophenyl)ethynyl]phenoxy]-6-methylundecoxy]-1-[2-(4-fluorophenyl)ethynyl]benzene |
| SMILES | CC(CCCCCOc1ccc(C#Cc2ccc(F)cc2)c(F)c1)CCCCCOc1ccc(C#Cc2ccc(F)cc2)c(F)c1 |
| InChI | InChI=1S/C40H38F4O2/c1-30(8-4-2-6-26-45-37-24-18-33(39(43)28-37)16-10-31-12-20-35(41)21-13-31)9-5-3-7-27-46-38-25-19-34(40(44)29-38)17-11-32-14-22-36(42)23-15-32/h12-15,18-25,28-30H,2-9,26-27H2,1H3 |
| InChIKey | ZMVDDRPZHFQJHI-UHFFFAOYSA-N |
| XLogP | 10.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.73 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|