C27H38F4O2 — CID 143909089
ethene;(4E,7Z,15Z)-7,8,15,16-tetrafluoro-17-methoxy-5,10,13-trimethyl-6,9,14-trimethylideneoctadeca-4,7,15,17-tetraen-2-ol (PubChem CID 143909089) has the molecular formula C27H38F4O2 and a molecular weight of 470.59 g/mol. Its IUPAC name is ethene;(4E,7Z,15Z)-7,8,15,16-tetrafluoro-17-methoxy-5,10,13-trimethyl-6,9,14-trimethylideneoctadeca-4,7,15,17-tetraen-2-ol.
| Compound Name | ethene;(4E,7Z,15Z)-7,8,15,16-tetrafluoro-17-methoxy-5,10,13-trimethyl-6,9,14-trimethylideneoctadeca-4,7,15,17-tetraen-2-ol |
|---|---|
| PubChem CID | 143909089 |
| Molecular Formula | C27H38F4O2 |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.28 |
| IUPAC Name | ethene;(4E,7Z,15Z)-7,8,15,16-tetrafluoro-17-methoxy-5,10,13-trimethyl-6,9,14-trimethylideneoctadeca-4,7,15,17-tetraen-2-ol |
| SMILES | C=C.C=C(OC)/C(F)=C(/F)C(=C)C(C)CCC(C)C(=C)/C(F)=C(/F)C(=C)/C(C)=C/CC(C)O |
| InChI | InChI=1S/C25H34F4O2.C2H4/c1-14(10-11-15(2)20(7)24(28)25(29)21(8)31-9)18(5)22(26)23(27)19(6)16(3)12-13-17(4)30;1-2/h12,14-15,17,30H,5-8,10-11,13H2,1-4,9H3;1-2H2/b16-12+,23-22-,25-24-; |
| InChIKey | ASADYPBQRQOKNO-XPQLMBNPSA-N |
| XLogP | 8.69 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|