C21H39F — CID 145312710
(E)-5-fluoro-4,7,10-trimethyl-3,6-dimethylidenetridec-4-ene;propane (PubChem CID 145312710) has the molecular formula C21H39F and a molecular weight of 310.54 g/mol. Its IUPAC name is (E)-5-fluoro-4,7,10-trimethyl-3,6-dimethylidenetridec-4-ene;propane.
| Compound Name | (E)-5-fluoro-4,7,10-trimethyl-3,6-dimethylidenetridec-4-ene;propane |
|---|---|
| PubChem CID | 145312710 |
| Molecular Formula | C21H39F |
| Molecular Weight | 310.54 g/mol |
| Exact Mass | 310.30 |
| IUPAC Name | (E)-5-fluoro-4,7,10-trimethyl-3,6-dimethylidenetridec-4-ene;propane |
| SMILES | C=C(CC)/C(C)=C(/F)C(=C)C(C)CCC(C)CCC.CCC |
| InChI | InChI=1S/C18H31F.C3H8/c1-8-10-13(3)11-12-15(5)17(7)18(19)16(6)14(4)9-2;1-3-2/h13,15H,4,7-12H2,1-3,5-6H3;3H2,1-2H3/b18-16+; |
| InChIKey | AUBHQXGHCXOAHI-HYNBPGMHSA-N |
| XLogP | 8.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.54 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|