About 4,10-dimethyltridecan-7-ol
4,10-dimethyltridecan-7-ol (PubChem CID 10633137) has the molecular formula C15H32O
and a molecular weight of 228.42 g/mol. Its IUPAC name is 4,10-dimethyltridecan-7-ol.
Molecular Properties
| Compound Name | 4,10-dimethyltridecan-7-ol |
| PubChem CID | 10633137 |
| Molecular Formula | C15H32O |
| Molecular Weight | 228.42 g/mol |
| Exact Mass | 228.25 |
| IUPAC Name | 4,10-dimethyltridecan-7-ol |
| SMILES | CCCC(C)CCC(O)CCC(C)CCC |
| InChI | InChI=1S/C15H32O/c1-5-7-13(3)9-11-15(16)12-10-14(4)8-6-2/h13-16H,5-12H2,1-4H3 |
| InChIKey | AJENDZPIDAIHGQ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.42 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,10-dimethyltridecan-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,10-dimethyltridecan-7-ol?
The IUPAC name of 4,10-dimethyltridecan-7-ol (CID 10633137) is 4,10-dimethyltridecan-7-ol.
What is the SMILES notation for 4,10-dimethyltridecan-7-ol?
The canonical SMILES for 4,10-dimethyltridecan-7-ol is CCCC(C)CCC(O)CCC(C)CCC.
What is the InChIKey of 4,10-dimethyltridecan-7-ol?
The InChIKey is AJENDZPIDAIHGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32O/c1-5-7-13(3)9-11-15(16)12-10-14(4)8-6-2/h13-16H,5-12H2,1-4H3.
What are the key properties of 4,10-dimethyltridecan-7-ol?
4,10-dimethyltridecan-7-ol has a molecular weight of 228.42 g/mol, XLogP of 4.78, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,10-dimethyltridecan-7-ol is sourced from PubChem (CID 10633137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).