C12H25NO2 — CID 89427274
3-butan-2-yloxy-N,N-diethyl-2-methylpropanamide (PubChem CID 89427274) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is 3-butan-2-yloxy-N,N-diethyl-2-methylpropanamide.
| Compound Name | 3-butan-2-yloxy-N,N-diethyl-2-methylpropanamide |
|---|---|
| PubChem CID | 89427274 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | 3-butan-2-yloxy-N,N-diethyl-2-methylpropanamide |
| SMILES | CCC(C)OCC(C)C(=O)N(CC)CC |
| InChI | InChI=1S/C12H25NO2/c1-6-11(5)15-9-10(4)12(14)13(7-2)8-3/h10-11H,6-9H2,1-5H3 |
| InChIKey | CXFWCXALVNLQMG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |