C15H32N2O — CID 166717183
4-(diethylamino)-N,N-diethyl-2,4-dimethylpentanamide (PubChem CID 166717183) has the molecular formula C15H32N2O and a molecular weight of 256.43 g/mol. Its IUPAC name is 4-(diethylamino)-N,N-diethyl-2,4-dimethylpentanamide.
| Compound Name | 4-(diethylamino)-N,N-diethyl-2,4-dimethylpentanamide |
|---|---|
| PubChem CID | 166717183 |
| Molecular Formula | C15H32N2O |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.25 |
| IUPAC Name | 4-(diethylamino)-N,N-diethyl-2,4-dimethylpentanamide |
| SMILES | CCN(CC)C(=O)C(C)CC(C)(C)N(CC)CC |
| InChI | InChI=1S/C15H32N2O/c1-8-16(9-2)14(18)13(5)12-15(6,7)17(10-3)11-4/h13H,8-12H2,1-7H3 |
| InChIKey | GCMVKCJZJGVXCC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |