About [4-(diethylamino)-3-methyl-4-oxobutyl] N,N-diethylcarbamate
[4-(diethylamino)-3-methyl-4-oxobutyl] N,N-diethylcarbamate (PubChem CID 122517637) has the molecular formula C14H28N2O3
and a molecular weight of 272.39 g/mol. Its IUPAC name is [4-(diethylamino)-3-methyl-4-oxobutyl] N,N-diethylcarbamate.
Analyze [4-(diethylamino)-3-methyl-4-oxobutyl] N,N-diethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(diethylamino)-3-methyl-4-oxobutyl] N,N-diethylcarbamate?
The IUPAC name of [4-(diethylamino)-3-methyl-4-oxobutyl] N,N-diethylcarbamate (CID 122517637) is [4-(diethylamino)-3-methyl-4-oxobutyl] N,N-diethylcarbamate.
What is the SMILES notation for [4-(diethylamino)-3-methyl-4-oxobutyl] N,N-diethylcarbamate?
The canonical SMILES for [4-(diethylamino)-3-methyl-4-oxobutyl] N,N-diethylcarbamate is CCN(CC)C(=O)OCCC(C)C(=O)N(CC)CC.
What is the InChIKey of [4-(diethylamino)-3-methyl-4-oxobutyl] N,N-diethylcarbamate?
The InChIKey is XHTJSPBSDXDQCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2O3/c1-6-15(7-2)13(17)12(5)10-11-19-14(18)16(8-3)9-4/h12H,6-11H2,1-5H3.
What are the key properties of [4-(diethylamino)-3-methyl-4-oxobutyl] N,N-diethylcarbamate?
[4-(diethylamino)-3-methyl-4-oxobutyl] N,N-diethylcarbamate has a molecular weight of 272.39 g/mol, XLogP of 2.36, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(diethylamino)-3-methyl-4-oxobutyl] N,N-diethylcarbamate is sourced from PubChem (CID 122517637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).