C7H7FO — CID 142607987
(3E)-3-fluoro-2-methylidenehexa-3,5-dienal (PubChem CID 142607987) has the molecular formula C7H7FO and a molecular weight of 126.13 g/mol. Its IUPAC name is (3E)-3-fluoro-2-methylidenehexa-3,5-dienal.
| Compound Name | (3E)-3-fluoro-2-methylidenehexa-3,5-dienal |
|---|---|
| PubChem CID | 142607987 |
| Molecular Formula | C7H7FO |
| Molecular Weight | 126.13 g/mol |
| Exact Mass | 126.05 |
| IUPAC Name | (3E)-3-fluoro-2-methylidenehexa-3,5-dienal |
| SMILES | C=C/C=C(/F)C(=C)C=O |
| InChI | InChI=1S/C7H7FO/c1-3-4-7(8)6(2)5-9/h3-5H,1-2H2/b7-4+ |
| InChIKey | ILHFOYITOKPEFW-QPJJXVBHSA-N |
| XLogP | 1.78 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.13 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|