C6H6OW — CID 58256469
[(2Z)-2-formylpenta-2,4-dienylidene]tungsten (PubChem CID 58256469) has the molecular formula C6H6OW and a molecular weight of 277.95 g/mol. Its IUPAC name is [(2Z)-2-formylpenta-2,4-dienylidene]tungsten.
| Compound Name | [(2Z)-2-formylpenta-2,4-dienylidene]tungsten |
|---|---|
| PubChem CID | 58256469 |
| Molecular Formula | C6H6OW |
| Molecular Weight | 277.95 g/mol |
| Exact Mass | 277.99 |
| IUPAC Name | [(2Z)-2-formylpenta-2,4-dienylidene]tungsten |
| SMILES | C=C/C=C(/C=O)C=[W] |
| InChI | InChI=1S/C6H6O.W/c1-3-4-6(2)5-7;/h2-5H,1H2;/b6-4+; |
| InChIKey | CKLCYSMDCHXOTH-CVDVRWGVSA-N |
| XLogP | 0.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.95 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|