About (2E,4Z)-4-ethenylhepta-2,4,6-trienal
(2E,4Z)-4-ethenylhepta-2,4,6-trienal (PubChem CID 118145094) has the molecular formula C9H10O
and a molecular weight of 134.18 g/mol. Its IUPAC name is (2E,4Z)-4-ethenylhepta-2,4,6-trienal.
Molecular Properties
| Compound Name | (2E,4Z)-4-ethenylhepta-2,4,6-trienal |
| PubChem CID | 118145094 |
| Molecular Formula | C9H10O |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | (2E,4Z)-4-ethenylhepta-2,4,6-trienal |
| SMILES | C=C/C=C(C=C)\C=C\C=O |
| InChI | InChI=1S/C9H10O/c1-3-6-9(4-2)7-5-8-10/h3-8H,1-2H2/b7-5+,9-6- |
| InChIKey | PSFCINJLBTZCFU-BEDCHXNXSA-N |
| XLogP | 2.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4Z)-4-ethenylhepta-2,4,6-trienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4Z)-4-ethenylhepta-2,4,6-trienal?
The IUPAC name of (2E,4Z)-4-ethenylhepta-2,4,6-trienal (CID 118145094) is (2E,4Z)-4-ethenylhepta-2,4,6-trienal.
What is the SMILES notation for (2E,4Z)-4-ethenylhepta-2,4,6-trienal?
The canonical SMILES for (2E,4Z)-4-ethenylhepta-2,4,6-trienal is C=C/C=C(C=C)\C=C\C=O.
What is the InChIKey of (2E,4Z)-4-ethenylhepta-2,4,6-trienal?
The InChIKey is PSFCINJLBTZCFU-BEDCHXNXSA-N. The full InChI is InChI=1S/C9H10O/c1-3-6-9(4-2)7-5-8-10/h3-8H,1-2H2/b7-5+,9-6-.
What are the key properties of (2E,4Z)-4-ethenylhepta-2,4,6-trienal?
(2E,4Z)-4-ethenylhepta-2,4,6-trienal has a molecular weight of 134.18 g/mol, XLogP of 2.04, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4Z)-4-ethenylhepta-2,4,6-trienal is sourced from PubChem (CID 118145094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).