C10H12O — CID 123696871
4-ethenylocta-2,4,7-trienal (PubChem CID 123696871) has the molecular formula C10H12O and a molecular weight of 148.20 g/mol. Its IUPAC name is 4-ethenylocta-2,4,7-trienal.
| Compound Name | 4-ethenylocta-2,4,7-trienal |
|---|---|
| PubChem CID | 123696871 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | 4-ethenylocta-2,4,7-trienal |
| SMILES | C=CCC=C(C=C)C=CC=O |
| InChI | InChI=1S/C10H12O/c1-3-5-7-10(4-2)8-6-9-11/h3-4,6-9H,1-2,5H2 |
| InChIKey | XHVDHQVTTSNRNC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|