C9H14O — CID 54147829
2-propan-2-ylhexa-2,5-dienal (PubChem CID 54147829) has the molecular formula C9H14O and a molecular weight of 138.21 g/mol. Its IUPAC name is 2-propan-2-ylhexa-2,5-dienal.
| Compound Name | 2-propan-2-ylhexa-2,5-dienal |
|---|---|
| PubChem CID | 54147829 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | 2-propan-2-ylhexa-2,5-dienal |
| SMILES | C=CCC=C(C=O)C(C)C |
| InChI | InChI=1S/C9H14O/c1-4-5-6-9(7-10)8(2)3/h4,6-8H,1,5H2,2-3H3 |
| InChIKey | OFPZTOKPFAZUMC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|