C6H9Br — CID 173459747
5-bromohexa-1,4-diene (PubChem CID 173459747) has the molecular formula C6H9Br and a molecular weight of 161.04 g/mol. Its IUPAC name is 5-bromohexa-1,4-diene.
| Compound Name | 5-bromohexa-1,4-diene |
|---|---|
| PubChem CID | 173459747 |
| Molecular Formula | C6H9Br |
| Molecular Weight | 161.04 g/mol |
| Exact Mass | 159.99 |
| IUPAC Name | 5-bromohexa-1,4-diene |
| SMILES | C=CCC=C(C)Br |
| InChI | InChI=1S/C6H9Br/c1-3-4-5-6(2)7/h3,5H,1,4H2,2H3 |
| InChIKey | YKBVAJJYRVVWLW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.04 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|