C7H11NO — CID 163730975
(4E)-5-methyl-6-nitrosohexa-1,4-diene (PubChem CID 163730975) has the molecular formula C7H11NO and a molecular weight of 125.17 g/mol. Its IUPAC name is (4E)-5-methyl-6-nitrosohexa-1,4-diene.
| Compound Name | (4E)-5-methyl-6-nitrosohexa-1,4-diene |
|---|---|
| PubChem CID | 163730975 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | (4E)-5-methyl-6-nitrosohexa-1,4-diene |
| SMILES | C=CC/C=C(\C)CN=O |
| InChI | InChI=1S/C7H11NO/c1-3-4-5-7(2)6-8-9/h3,5H,1,4,6H2,2H3/b7-5+ |
| InChIKey | KZMWTNQRXNCSBV-FNORWQNLSA-N |
| XLogP | 2.28 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|