C13H25NO — CID 91456712
2,5,9-trimethyl-1-nitrosodec-2-ene (PubChem CID 91456712) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is 2,5,9-trimethyl-1-nitrosodec-2-ene.
| Compound Name | 2,5,9-trimethyl-1-nitrosodec-2-ene |
|---|---|
| PubChem CID | 91456712 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | 2,5,9-trimethyl-1-nitrosodec-2-ene |
| SMILES | CC(=CCC(C)CCCC(C)C)CN=O |
| InChI | InChI=1S/C13H25NO/c1-11(2)6-5-7-12(3)8-9-13(4)10-14-15/h9,11-12H,5-8,10H2,1-4H3 |
| InChIKey | DKZYDCKINJBZAA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|