About (2Z)-N,3-di(propan-2-yl)penta-2,4-dien-1-amine
(2Z)-N,3-di(propan-2-yl)penta-2,4-dien-1-amine (PubChem CID 166807119) has the molecular formula C11H21N
and a molecular weight of 167.30 g/mol. Its IUPAC name is (2Z)-N,3-di(propan-2-yl)penta-2,4-dien-1-amine.
Molecular Properties
| Compound Name | (2Z)-N,3-di(propan-2-yl)penta-2,4-dien-1-amine |
| PubChem CID | 166807119 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | (2Z)-N,3-di(propan-2-yl)penta-2,4-dien-1-amine |
| SMILES | C=C/C(=C\CNC(C)C)C(C)C |
| InChI | InChI=1S/C11H21N/c1-6-11(9(2)3)7-8-12-10(4)5/h6-7,9-10,12H,1,8H2,2-5H3/b11-7+ |
| InChIKey | BQPSJGYRZXXRNN-YRNVUSSQSA-N |
| XLogP | 2.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-N,3-di(propan-2-yl)penta-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-N,3-di(propan-2-yl)penta-2,4-dien-1-amine?
The IUPAC name of (2Z)-N,3-di(propan-2-yl)penta-2,4-dien-1-amine (CID 166807119) is (2Z)-N,3-di(propan-2-yl)penta-2,4-dien-1-amine.
What is the SMILES notation for (2Z)-N,3-di(propan-2-yl)penta-2,4-dien-1-amine?
The canonical SMILES for (2Z)-N,3-di(propan-2-yl)penta-2,4-dien-1-amine is C=C/C(=C\CNC(C)C)C(C)C.
What is the InChIKey of (2Z)-N,3-di(propan-2-yl)penta-2,4-dien-1-amine?
The InChIKey is BQPSJGYRZXXRNN-YRNVUSSQSA-N. The full InChI is InChI=1S/C11H21N/c1-6-11(9(2)3)7-8-12-10(4)5/h6-7,9-10,12H,1,8H2,2-5H3/b11-7+.
What are the key properties of (2Z)-N,3-di(propan-2-yl)penta-2,4-dien-1-amine?
(2Z)-N,3-di(propan-2-yl)penta-2,4-dien-1-amine has a molecular weight of 167.30 g/mol, XLogP of 2.75, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-N,3-di(propan-2-yl)penta-2,4-dien-1-amine is sourced from PubChem (CID 166807119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).