C13H25N — CID 171073812
ethane;(2Z,4Z)-N-methyl-5-propan-2-ylhepta-2,4,6-trien-3-amine (PubChem CID 171073812) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is ethane;(2Z,4Z)-N-methyl-5-propan-2-ylhepta-2,4,6-trien-3-amine.
| Compound Name | ethane;(2Z,4Z)-N-methyl-5-propan-2-ylhepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 171073812 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | ethane;(2Z,4Z)-N-methyl-5-propan-2-ylhepta-2,4,6-trien-3-amine |
| SMILES | C=C/C(=C\C(=C\C)NC)C(C)C.CC |
| InChI | InChI=1S/C11H19N.C2H6/c1-6-10(9(3)4)8-11(7-2)12-5;1-2/h6-9,12H,1H2,2-5H3;1-2H3/b10-8+,11-7-; |
| InChIKey | MDMULCPRQXFJNN-GOZDGITISA-N |
| XLogP | 3.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|