C12H18O — CID 142046409
(5Z)-4-methylidene-6-propan-2-ylocta-5,7-dien-3-one (PubChem CID 142046409) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is (5Z)-4-methylidene-6-propan-2-ylocta-5,7-dien-3-one.
| Compound Name | (5Z)-4-methylidene-6-propan-2-ylocta-5,7-dien-3-one |
|---|---|
| PubChem CID | 142046409 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (5Z)-4-methylidene-6-propan-2-ylocta-5,7-dien-3-one |
| SMILES | C=C/C(=C\C(=C)C(=O)CC)C(C)C |
| InChI | InChI=1S/C12H18O/c1-6-11(9(3)4)8-10(5)12(13)7-2/h6,8-9H,1,5,7H2,2-4H3/b11-8+ |
| InChIKey | VJGYODDCTZRCSN-DHZHZOJOSA-N |
| XLogP | 3.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|