About 4-(hydroxymethylidene)deca-2,9-dienal
4-(hydroxymethylidene)deca-2,9-dienal (PubChem CID 24787710) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is 4-(hydroxymethylidene)deca-2,9-dienal.
Molecular Properties
| Compound Name | 4-(hydroxymethylidene)deca-2,9-dienal |
| PubChem CID | 24787710 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 4-(hydroxymethylidene)deca-2,9-dienal |
| SMILES | C=CCCCCC(C=CC=O)=CO |
| InChI | InChI=1S/C11H16O2/c1-2-3-4-5-7-11(10-13)8-6-9-12/h2,6,8-10,13H,1,3-5,7H2 |
| InChIKey | NBCYLUOAQPUWKC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(hydroxymethylidene)deca-2,9-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(hydroxymethylidene)deca-2,9-dienal?
The IUPAC name of 4-(hydroxymethylidene)deca-2,9-dienal (CID 24787710) is 4-(hydroxymethylidene)deca-2,9-dienal.
What is the SMILES notation for 4-(hydroxymethylidene)deca-2,9-dienal?
The canonical SMILES for 4-(hydroxymethylidene)deca-2,9-dienal is C=CCCCCC(C=CC=O)=CO.
What is the InChIKey of 4-(hydroxymethylidene)deca-2,9-dienal?
The InChIKey is NBCYLUOAQPUWKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2/c1-2-3-4-5-7-11(10-13)8-6-9-12/h2,6,8-10,13H,1,3-5,7H2.
What are the key properties of 4-(hydroxymethylidene)deca-2,9-dienal?
4-(hydroxymethylidene)deca-2,9-dienal has a molecular weight of 180.25 g/mol, XLogP of 2.93, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(hydroxymethylidene)deca-2,9-dienal is sourced from PubChem (CID 24787710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).