C9H13FOS — CID 142138800
methyl thiohypofluorite;(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienal (PubChem CID 142138800) has the molecular formula C9H13FOS and a molecular weight of 188.27 g/mol. Its IUPAC name is methyl thiohypofluorite;(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienal.
| Compound Name | methyl thiohypofluorite;(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienal |
|---|---|
| PubChem CID | 142138800 |
| Molecular Formula | C9H13FOS |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | methyl thiohypofluorite;(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienal |
| SMILES | C=C/C=C(C=O)\C=C/C.CSF |
| InChI | InChI=1S/C8H10O.CH3FS/c1-3-5-8(7-9)6-4-2;1-3-2/h3-7H,1H2,2H3;1H3/b6-4-,8-5+; |
| InChIKey | FLYKXBSSTZCJSL-CSXGQTSLSA-N |
| XLogP | 3.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|