C10H16O2 — CID 142143144
methanol;(2E)-4-methyl-2-[(Z)-prop-1-enyl]penta-2,4-dienal (PubChem CID 142143144) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is methanol;(2E)-4-methyl-2-[(Z)-prop-1-enyl]penta-2,4-dienal.
| Compound Name | methanol;(2E)-4-methyl-2-[(Z)-prop-1-enyl]penta-2,4-dienal |
|---|---|
| PubChem CID | 142143144 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | methanol;(2E)-4-methyl-2-[(Z)-prop-1-enyl]penta-2,4-dienal |
| SMILES | C=C(C)/C=C(C=O)\C=C/C.CO |
| InChI | InChI=1S/C9H12O.CH4O/c1-4-5-9(7-10)6-8(2)3;1-2/h4-7H,2H2,1,3H3;2H,1H3/b5-4-,9-6+; |
| InChIKey | FXISTJXRWXUCQD-QKPHYRDRSA-N |
| XLogP | 1.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|