C10H14N2O2 — CID 130471238
1-hydroxy-3-[(1E,3E)-3-[(Z)-prop-1-enyl]hexa-1,3,5-trienyl]urea (PubChem CID 130471238) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 1-hydroxy-3-[(1E,3E)-3-[(Z)-prop-1-enyl]hexa-1,3,5-trienyl]urea.
| Compound Name | 1-hydroxy-3-[(1E,3E)-3-[(Z)-prop-1-enyl]hexa-1,3,5-trienyl]urea |
|---|---|
| PubChem CID | 130471238 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 1-hydroxy-3-[(1E,3E)-3-[(Z)-prop-1-enyl]hexa-1,3,5-trienyl]urea |
| SMILES | C=C/C=C(\C=C/C)/C=C/NC(=O)NO |
| InChI | InChI=1S/C10H14N2O2/c1-3-5-9(6-4-2)7-8-11-10(13)12-14/h3-8,14H,1H2,2H3,(H2,11,12,13)/b6-4-,8-7+,9-5+ |
| InChIKey | AUXVQKQHSUOTGI-XMORXVDMSA-N |
| XLogP | 1.88 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|