C16H27N — CID 143658609
1,4-dimethylpiperidine;(3Z,5Z)-4-ethenylhepta-1,3,5-triene (PubChem CID 143658609) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is 1,4-dimethylpiperidine;(3Z,5Z)-4-ethenylhepta-1,3,5-triene.
| Compound Name | 1,4-dimethylpiperidine;(3Z,5Z)-4-ethenylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 143658609 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | 1,4-dimethylpiperidine;(3Z,5Z)-4-ethenylhepta-1,3,5-triene |
| SMILES | C=C/C=C(C=C)\C=C/C.CC1CCN(C)CC1 |
| InChI | InChI=1S/C9H12.C7H15N/c1-4-7-9(6-3)8-5-2;1-7-3-5-8(2)6-4-7/h4-8H,1,3H2,2H3;7H,3-6H2,1-2H3/b8-5-,9-7-; |
| InChIKey | WHLXYPQHQBRPIA-ITPZDKBUSA-N |
| XLogP | 4.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|