C19H34O2 — CID 143775190
ethane;ethene;[(5E)-5-ethenyl-2,4,4-trimethylocta-5,7-dien-2-yl] acetate (PubChem CID 143775190) has the molecular formula C19H34O2 and a molecular weight of 294.48 g/mol. Its IUPAC name is ethane;ethene;[(5E)-5-ethenyl-2,4,4-trimethylocta-5,7-dien-2-yl] acetate.
| Compound Name | ethane;ethene;[(5E)-5-ethenyl-2,4,4-trimethylocta-5,7-dien-2-yl] acetate |
|---|---|
| PubChem CID | 143775190 |
| Molecular Formula | C19H34O2 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.26 |
| IUPAC Name | ethane;ethene;[(5E)-5-ethenyl-2,4,4-trimethylocta-5,7-dien-2-yl] acetate |
| SMILES | C=C.C=C/C=C(\C=C)C(C)(C)CC(C)(C)OC(C)=O.CC |
| InChI | InChI=1S/C15H24O2.C2H6.C2H4/c1-8-10-13(9-2)14(4,5)11-15(6,7)17-12(3)16;2*1-2/h8-10H,1-2,11H2,3-7H3;1-2H3;1-2H2/b13-10+;; |
| InChIKey | UWUFOOCEVHTUGH-JFXLULTRSA-N |
| XLogP | 5.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|