C23H44O3 — CID 142502654
ethane;(3E)-4-ethenyl-5,5,7-trimethylocta-1,3-diene;heptan-4-yl hydrogen carbonate (PubChem CID 142502654) has the molecular formula C23H44O3 and a molecular weight of 368.60 g/mol. Its IUPAC name is ethane;(3E)-4-ethenyl-5,5,7-trimethylocta-1,3-diene;heptan-4-yl hydrogen carbonate.
| Compound Name | ethane;(3E)-4-ethenyl-5,5,7-trimethylocta-1,3-diene;heptan-4-yl hydrogen carbonate |
|---|---|
| PubChem CID | 142502654 |
| Molecular Formula | C23H44O3 |
| Molecular Weight | 368.60 g/mol |
| Exact Mass | 368.33 |
| IUPAC Name | ethane;(3E)-4-ethenyl-5,5,7-trimethylocta-1,3-diene;heptan-4-yl hydrogen carbonate |
| SMILES | C=C/C=C(\C=C)C(C)(C)CC(C)C.CC.CCCC(CCC)OC(=O)O |
| InChI | InChI=1S/C13H22.C8H16O3.C2H6/c1-7-9-12(8-2)13(5,6)10-11(3)4;1-3-5-7(6-4-2)11-8(9)10;1-2/h7-9,11H,1-2,10H2,3-6H3;7H,3-6H2,1-2H3,(H,9,10);1-2H3/b12-9+;; |
| InChIKey | OHLBCTCPLCMKEQ-ANOGCNOSSA-N |
| XLogP | 8.03 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.60 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|