C19H32O3 — CID 138602917
2-methyl-4-[3-methyl-1-[(3E,5Z)-octa-1,3,5,7-tetraen-3-yl]oxypentan-3-yl]oxybutan-2-ol (PubChem CID 138602917) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is 2-methyl-4-[3-methyl-1-[(3E,5Z)-octa-1,3,5,7-tetraen-3-yl]oxypentan-3-yl]oxybutan-2-ol.
| Compound Name | 2-methyl-4-[3-methyl-1-[(3E,5Z)-octa-1,3,5,7-tetraen-3-yl]oxypentan-3-yl]oxybutan-2-ol |
|---|---|
| PubChem CID | 138602917 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | 2-methyl-4-[3-methyl-1-[(3E,5Z)-octa-1,3,5,7-tetraen-3-yl]oxypentan-3-yl]oxybutan-2-ol |
| SMILES | C=C/C=C\C=C(/C=C)OCCC(C)(CC)OCCC(C)(C)O |
| InChI | InChI=1S/C19H32O3/c1-7-10-11-12-17(8-2)21-15-14-19(6,9-3)22-16-13-18(4,5)20/h7-8,10-12,20H,1-2,9,13-16H2,3-6H3/b11-10-,17-12+ |
| InChIKey | AMMQUSDKSKZKTB-WUSHYMHTSA-N |
| XLogP | 4.55 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|