C32H53O6P — CID 138624371
2-[3-methyl-3-[(3E,5Z)-octa-1,3,5,7-tetraen-3-yl]oxybutoxy]propan-2-yl-[2-[3-methyl-3-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]oxybutoxy]propan-2-yl]phosphinic acid (PubChem CID 138624371) has the molecular formula C32H53O6P and a molecular weight of 564.74 g/mol. Its IUPAC name is 2-[3-methyl-3-[(3E,5Z)-octa-1,3,5,7-tetraen-3-yl]oxybutoxy]propan-2-yl-[2-[3-methyl-3-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]oxybutoxy]propan-2-yl]phosphinic acid.
| Compound Name | 2-[3-methyl-3-[(3E,5Z)-octa-1,3,5,7-tetraen-3-yl]oxybutoxy]propan-2-yl-[2-[3-methyl-3-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]oxybutoxy]propan-2-yl]phosphinic acid |
|---|---|
| PubChem CID | 138624371 |
| Molecular Formula | C32H53O6P |
| Molecular Weight | 564.74 g/mol |
| Exact Mass | 564.36 |
| IUPAC Name | 2-[3-methyl-3-[(3E,5Z)-octa-1,3,5,7-tetraen-3-yl]oxybutoxy]propan-2-yl-[2-[3-methyl-3-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]oxybutoxy]propan-2-yl]phosphinic acid |
| SMILES | C=C/C=C\C=C(/C=C)OC(C)(C)CCOC(C)(C)P(=O)(O)C(C)(C)OCCC(C)(C)OC(/C=C\C=C/C)=C/C |
| InChI | InChI=1S/C32H53O6P/c1-13-17-19-21-27(15-3)37-29(5,6)23-25-35-31(9,10)39(33,34)32(11,12)36-26-24-30(7,8)38-28(16-4)22-20-18-14-2/h13-22H,1,3,23-26H2,2,4-12H3,(H,33,34)/b18-14-,19-17-,22-20-,27-21+,28-16+ |
| InChIKey | FLUGEYJBPXHIQQ-GXTDHTGHSA-N |
| XLogP | 8.98 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.74 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|