C14H22 — CID 142088084
(3Z,8E)-4-ethenyl-6,6-dimethyldeca-1,3,8-triene (PubChem CID 142088084) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is (3Z,8E)-4-ethenyl-6,6-dimethyldeca-1,3,8-triene.
| Compound Name | (3Z,8E)-4-ethenyl-6,6-dimethyldeca-1,3,8-triene |
|---|---|
| PubChem CID | 142088084 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | (3Z,8E)-4-ethenyl-6,6-dimethyldeca-1,3,8-triene |
| SMILES | C=C/C=C(\C=C)CC(C)(C)C/C=C/C |
| InChI | InChI=1S/C14H22/c1-6-9-11-14(4,5)12-13(8-3)10-7-2/h6-10H,2-3,11-12H2,1,4-5H3/b9-6+,13-10+ |
| InChIKey | HDKNNSRYRSTXTL-DEKJKZHBSA-N |
| XLogP | 4.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|