C23H42O — CID 123947721
4,7-diethyl-4,5,7,10,10-pentamethyltetradeca-1,12-dien-3-one (PubChem CID 123947721) has the molecular formula C23H42O and a molecular weight of 334.59 g/mol. Its IUPAC name is 4,7-diethyl-4,5,7,10,10-pentamethyltetradeca-1,12-dien-3-one.
| Compound Name | 4,7-diethyl-4,5,7,10,10-pentamethyltetradeca-1,12-dien-3-one |
|---|---|
| PubChem CID | 123947721 |
| Molecular Formula | C23H42O |
| Molecular Weight | 334.59 g/mol |
| Exact Mass | 334.32 |
| IUPAC Name | 4,7-diethyl-4,5,7,10,10-pentamethyltetradeca-1,12-dien-3-one |
| SMILES | C=CC(=O)C(C)(CC)C(C)CC(C)(CC)CCC(C)(C)CC=CC |
| InChI | InChI=1S/C23H42O/c1-10-14-15-21(6,7)16-17-22(8,12-3)18-19(5)23(9,13-4)20(24)11-2/h10-11,14,19H,2,12-13,15-18H2,1,3-9H3 |
| InChIKey | MJPORPOFENUESN-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.59 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|