About (E)-3-ethenyl-4,4-dimethyloct-6-en-2-one
(E)-3-ethenyl-4,4-dimethyloct-6-en-2-one (PubChem CID 88713054) has the molecular formula C12H20O
and a molecular weight of 180.29 g/mol. Its IUPAC name is (E)-3-ethenyl-4,4-dimethyloct-6-en-2-one.
Molecular Properties
| Compound Name | (E)-3-ethenyl-4,4-dimethyloct-6-en-2-one |
| PubChem CID | 88713054 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (E)-3-ethenyl-4,4-dimethyloct-6-en-2-one |
| SMILES | C=CC(C(C)=O)C(C)(C)C/C=C/C |
| InChI | InChI=1S/C12H20O/c1-6-8-9-12(4,5)11(7-2)10(3)13/h6-8,11H,2,9H2,1,3-5H3/b8-6+ |
| InChIKey | FYYIQGVFQDLCIG-SOFGYWHQSA-N |
| XLogP | 3.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-ethenyl-4,4-dimethyloct-6-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-ethenyl-4,4-dimethyloct-6-en-2-one?
The IUPAC name of (E)-3-ethenyl-4,4-dimethyloct-6-en-2-one (CID 88713054) is (E)-3-ethenyl-4,4-dimethyloct-6-en-2-one.
What is the SMILES notation for (E)-3-ethenyl-4,4-dimethyloct-6-en-2-one?
The canonical SMILES for (E)-3-ethenyl-4,4-dimethyloct-6-en-2-one is C=CC(C(C)=O)C(C)(C)C/C=C/C.
What is the InChIKey of (E)-3-ethenyl-4,4-dimethyloct-6-en-2-one?
The InChIKey is FYYIQGVFQDLCIG-SOFGYWHQSA-N. The full InChI is InChI=1S/C12H20O/c1-6-8-9-12(4,5)11(7-2)10(3)13/h6-8,11H,2,9H2,1,3-5H3/b8-6+.
What are the key properties of (E)-3-ethenyl-4,4-dimethyloct-6-en-2-one?
(E)-3-ethenyl-4,4-dimethyloct-6-en-2-one has a molecular weight of 180.29 g/mol, XLogP of 3.37, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-ethenyl-4,4-dimethyloct-6-en-2-one is sourced from PubChem (CID 88713054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).