About 5-ethyl-5,8,8-trimethyldecanal
5-ethyl-5,8,8-trimethyldecanal (PubChem CID 123353165) has the molecular formula C15H30O
and a molecular weight of 226.40 g/mol. Its IUPAC name is 5-ethyl-5,8,8-trimethyldecanal.
Molecular Properties
| Compound Name | 5-ethyl-5,8,8-trimethyldecanal |
| PubChem CID | 123353165 |
| Molecular Formula | C15H30O |
| Molecular Weight | 226.40 g/mol |
| Exact Mass | 226.23 |
| IUPAC Name | 5-ethyl-5,8,8-trimethyldecanal |
| SMILES | CCC(C)(C)CCC(C)(CC)CCCC=O |
| InChI | InChI=1S/C15H30O/c1-6-14(3,4)11-12-15(5,7-2)10-8-9-13-16/h13H,6-12H2,1-5H3 |
| InChIKey | MVLKWQTWJAKABC-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.40 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-5,8,8-trimethyldecanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-5,8,8-trimethyldecanal?
The IUPAC name of 5-ethyl-5,8,8-trimethyldecanal (CID 123353165) is 5-ethyl-5,8,8-trimethyldecanal.
What is the SMILES notation for 5-ethyl-5,8,8-trimethyldecanal?
The canonical SMILES for 5-ethyl-5,8,8-trimethyldecanal is CCC(C)(C)CCC(C)(CC)CCCC=O.
What is the InChIKey of 5-ethyl-5,8,8-trimethyldecanal?
The InChIKey is MVLKWQTWJAKABC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O/c1-6-14(3,4)11-12-15(5,7-2)10-8-9-13-16/h13H,6-12H2,1-5H3.
What are the key properties of 5-ethyl-5,8,8-trimethyldecanal?
5-ethyl-5,8,8-trimethyldecanal has a molecular weight of 226.40 g/mol, XLogP of 4.99, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-5,8,8-trimethyldecanal is sourced from PubChem (CID 123353165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).