C16H25N — CID 142134372
(6Z,8Z)-6-ethenyl-N-methyl-3-propan-2-ylidenedeca-6,8-dien-2-imine (PubChem CID 142134372) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is (6Z,8Z)-6-ethenyl-N-methyl-3-propan-2-ylidenedeca-6,8-dien-2-imine.
| Compound Name | (6Z,8Z)-6-ethenyl-N-methyl-3-propan-2-ylidenedeca-6,8-dien-2-imine |
|---|---|
| PubChem CID | 142134372 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | (6Z,8Z)-6-ethenyl-N-methyl-3-propan-2-ylidenedeca-6,8-dien-2-imine |
| SMILES | C=C/C(=C\C=C/C)CCC(=C(C)C)/C(C)=N/C |
| InChI | InChI=1S/C16H25N/c1-7-9-10-15(8-2)11-12-16(13(3)4)14(5)17-6/h7-10H,2,11-12H2,1,3-6H3/b9-7-,15-10+,17-14+ |
| InChIKey | KTFVVOGNAZEWRV-PJOIXQPESA-N |
| XLogP | 4.88 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|