C14H19NO2 — CID 129301987
(4E,8Z,10Z)-8-ethenyl-4-hydroxy-3-iminododeca-4,8,10-trien-2-one (PubChem CID 129301987) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is (4E,8Z,10Z)-8-ethenyl-4-hydroxy-3-iminododeca-4,8,10-trien-2-one.
| Compound Name | (4E,8Z,10Z)-8-ethenyl-4-hydroxy-3-iminododeca-4,8,10-trien-2-one |
|---|---|
| PubChem CID | 129301987 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (4E,8Z,10Z)-8-ethenyl-4-hydroxy-3-iminododeca-4,8,10-trien-2-one |
| SMILES | [H]/N=C(C(C)=O)/C(O)=C\CC/C(C=C)=C/C=C\C |
| InChI | InChI=1S/C14H19NO2/c1-4-6-8-12(5-2)9-7-10-13(17)14(15)11(3)16/h4-6,8,10,15,17H,2,7,9H2,1,3H3/b6-4-,12-8+,13-10+,15-14+ |
| InChIKey | HMBUOIPOFMEHCF-XAPAHQAZSA-N |
| XLogP | 3.51 |
| TPSA | 61.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|