C15H21N — CID 142155560
(2Z,8Z,10Z)-8-ethenyl-3-methyldodeca-2,8,10-trienenitrile (PubChem CID 142155560) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is (2Z,8Z,10Z)-8-ethenyl-3-methyldodeca-2,8,10-trienenitrile.
| Compound Name | (2Z,8Z,10Z)-8-ethenyl-3-methyldodeca-2,8,10-trienenitrile |
|---|---|
| PubChem CID | 142155560 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | (2Z,8Z,10Z)-8-ethenyl-3-methyldodeca-2,8,10-trienenitrile |
| SMILES | C=C/C(=C\C=C/C)CCCC/C(C)=C\C#N |
| InChI | InChI=1S/C15H21N/c1-4-6-10-15(5-2)11-8-7-9-14(3)12-13-16/h4-6,10,12H,2,7-9,11H2,1,3H3/b6-4-,14-12-,15-10+ |
| InChIKey | LSVLZSPIPZUDSY-GLHWVVDMSA-N |
| XLogP | 4.71 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|