C22H38O — CID 142864253
cyclohexane;(8Z,10Z)-8-ethenyl-3-ethyldodeca-8,10-dien-2-one (PubChem CID 142864253) has the molecular formula C22H38O and a molecular weight of 318.55 g/mol. Its IUPAC name is cyclohexane;(8Z,10Z)-8-ethenyl-3-ethyldodeca-8,10-dien-2-one.
| Compound Name | cyclohexane;(8Z,10Z)-8-ethenyl-3-ethyldodeca-8,10-dien-2-one |
|---|---|
| PubChem CID | 142864253 |
| Molecular Formula | C22H38O |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 318.29 |
| IUPAC Name | cyclohexane;(8Z,10Z)-8-ethenyl-3-ethyldodeca-8,10-dien-2-one |
| SMILES | C1CCCCC1.C=C/C(=C\C=C/C)CCCCC(CC)C(C)=O |
| InChI | InChI=1S/C16H26O.C6H12/c1-5-8-11-15(6-2)12-9-10-13-16(7-3)14(4)17;1-2-4-6-5-3-1/h5-6,8,11,16H,2,7,9-10,12-13H2,1,3-4H3;1-6H2/b8-5-,15-11+; |
| InChIKey | HBWHHPHCCBSXQW-PNROHPQISA-N |
| XLogP | 7.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|