C23H40O — CID 144983518
acetaldehyde;ethane;(2Z,4Z,9Z,10Z)-5-ethenyl-9-ethylidene-8-propyldodeca-2,4,10-triene (PubChem CID 144983518) has the molecular formula C23H40O and a molecular weight of 332.57 g/mol. Its IUPAC name is acetaldehyde;ethane;(2Z,4Z,9Z,10Z)-5-ethenyl-9-ethylidene-8-propyldodeca-2,4,10-triene.
| Compound Name | acetaldehyde;ethane;(2Z,4Z,9Z,10Z)-5-ethenyl-9-ethylidene-8-propyldodeca-2,4,10-triene |
|---|---|
| PubChem CID | 144983518 |
| Molecular Formula | C23H40O |
| Molecular Weight | 332.57 g/mol |
| Exact Mass | 332.31 |
| IUPAC Name | acetaldehyde;ethane;(2Z,4Z,9Z,10Z)-5-ethenyl-9-ethylidene-8-propyldodeca-2,4,10-triene |
| SMILES | C=C/C(=C\C=C/C)CCC(CCC)C(/C=C\C)=C/C.CC.CC=O |
| InChI | InChI=1S/C19H30.C2H4O.C2H6/c1-6-11-14-17(9-4)15-16-19(13-8-3)18(10-5)12-7-2;1-2-3;1-2/h6-7,9-12,14,19H,4,8,13,15-16H2,1-3,5H3;2H,1H3;1-2H3/b11-6-,12-7-,17-14+,18-10+;; |
| InChIKey | KMGKZKXISROQIQ-JTCCKJSHSA-N |
| XLogP | 7.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.57 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|