C16H29NO — CID 143222339
ethane;(6Z,8Z)-5-methyl-6-[(Z)-prop-1-enyl]deca-6,8-dienamide (PubChem CID 143222339) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is ethane;(6Z,8Z)-5-methyl-6-[(Z)-prop-1-enyl]deca-6,8-dienamide.
| Compound Name | ethane;(6Z,8Z)-5-methyl-6-[(Z)-prop-1-enyl]deca-6,8-dienamide |
|---|---|
| PubChem CID | 143222339 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | ethane;(6Z,8Z)-5-methyl-6-[(Z)-prop-1-enyl]deca-6,8-dienamide |
| SMILES | C/C=C\C=C(/C=C\C)C(C)CCCC(N)=O.CC |
| InChI | InChI=1S/C14H23NO.C2H6/c1-4-6-10-13(8-5-2)12(3)9-7-11-14(15)16;1-2/h4-6,8,10,12H,7,9,11H2,1-3H3,(H2,15,16);1-2H3/b6-4-,8-5-,13-10+; |
| InChIKey | VRYMBMWDJOWHOM-VQKWTORQSA-N |
| XLogP | 4.38 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|