C22H37N — CID 139363670
(5Z)-6-ethenyl-N-[(2E,4Z)-hexa-2,4-dien-2-yl]-N-methyltrideca-1,5-dien-2-amine (PubChem CID 139363670) has the molecular formula C22H37N and a molecular weight of 315.55 g/mol. Its IUPAC name is (5Z)-6-ethenyl-N-[(2E,4Z)-hexa-2,4-dien-2-yl]-N-methyltrideca-1,5-dien-2-amine.
| Compound Name | (5Z)-6-ethenyl-N-[(2E,4Z)-hexa-2,4-dien-2-yl]-N-methyltrideca-1,5-dien-2-amine |
|---|---|
| PubChem CID | 139363670 |
| Molecular Formula | C22H37N |
| Molecular Weight | 315.55 g/mol |
| Exact Mass | 315.29 |
| IUPAC Name | (5Z)-6-ethenyl-N-[(2E,4Z)-hexa-2,4-dien-2-yl]-N-methyltrideca-1,5-dien-2-amine |
| SMILES | C=C/C(=C\CCC(=C)N(C)/C(C)=C/C=C\C)CCCCCCC |
| InChI | InChI=1S/C22H37N/c1-7-10-12-13-14-18-22(9-3)19-15-17-21(5)23(6)20(4)16-11-8-2/h8-9,11,16,19H,3,5,7,10,12-15,17-18H2,1-2,4,6H3/b11-8-,20-16+,22-19+ |
| InChIKey | FRZXZQSTFJRMBD-XWWHUCFXSA-N |
| XLogP | 7.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.55 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|