C17H30O2S — CID 145045288
ethane;(2E,4E)-5-[(2E,4Z)-6-hydroxyhexa-2,4-dien-3-yl]sulfanylhepta-2,4,6-trien-2-ol (PubChem CID 145045288) has the molecular formula C17H30O2S and a molecular weight of 298.49 g/mol. Its IUPAC name is ethane;(2E,4E)-5-[(2E,4Z)-6-hydroxyhexa-2,4-dien-3-yl]sulfanylhepta-2,4,6-trien-2-ol.
| Compound Name | ethane;(2E,4E)-5-[(2E,4Z)-6-hydroxyhexa-2,4-dien-3-yl]sulfanylhepta-2,4,6-trien-2-ol |
|---|---|
| PubChem CID | 145045288 |
| Molecular Formula | C17H30O2S |
| Molecular Weight | 298.49 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | ethane;(2E,4E)-5-[(2E,4Z)-6-hydroxyhexa-2,4-dien-3-yl]sulfanylhepta-2,4,6-trien-2-ol |
| SMILES | C=C/C(=C\C=C(/C)O)SC(/C=C\CO)=C/C.CC.CC |
| InChI | InChI=1S/C13H18O2S.2C2H6/c1-4-12(7-6-10-14)16-13(5-2)9-8-11(3)15;2*1-2/h4-9,14-15H,2,10H2,1,3H3;2*1-2H3/b7-6-,11-8+,12-4+,13-9+;; |
| InChIKey | OENKUNOMIAPTJS-GZPNSSGMSA-N |
| XLogP | 5.76 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.49 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|