C14H20O4 — CID 102532219
(2E,6E)-4,5-bis[(E)-3-hydroxyprop-1-enyl]octa-2,4,6-triene-1,8-diol (PubChem CID 102532219) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is (2E,6E)-4,5-bis[(E)-3-hydroxyprop-1-enyl]octa-2,4,6-triene-1,8-diol.
| Compound Name | (2E,6E)-4,5-bis[(E)-3-hydroxyprop-1-enyl]octa-2,4,6-triene-1,8-diol |
|---|---|
| PubChem CID | 102532219 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (2E,6E)-4,5-bis[(E)-3-hydroxyprop-1-enyl]octa-2,4,6-triene-1,8-diol |
| SMILES | OC/C=C/C(/C=C/CO)=C(/C=C/CO)/C=C/CO |
| InChI | InChI=1S/C14H20O4/c15-9-1-5-13(6-2-10-16)14(7-3-11-17)8-4-12-18/h1-8,15-18H,9-12H2/b5-1+,6-2+,7-3+,8-4+ |
| InChIKey | VSQJPCFECTXLIY-VYUKIJHXSA-N |
| XLogP | 0.48 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|