About (2E)-penta-2,4-diene-1,4-diol
(2E)-penta-2,4-diene-1,4-diol (PubChem CID 87933185) has the molecular formula C5H8O2
and a molecular weight of 100.12 g/mol. Its IUPAC name is (2E)-penta-2,4-diene-1,4-diol.
Molecular Properties
| Compound Name | (2E)-penta-2,4-diene-1,4-diol |
| PubChem CID | 87933185 |
| Molecular Formula | C5H8O2 |
| Molecular Weight | 100.12 g/mol |
| Exact Mass | 100.05 |
| IUPAC Name | (2E)-penta-2,4-diene-1,4-diol |
| SMILES | C=C(O)/C=C/CO |
| InChI | InChI=1S/C5H8O2/c1-5(7)3-2-4-6/h2-3,6-7H,1,4H2/b3-2+ |
| InChIKey | OMNUJUJYJXOIRM-NSCUHMNNSA-N |
| XLogP | 0.61 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.12 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-penta-2,4-diene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-penta-2,4-diene-1,4-diol?
The IUPAC name of (2E)-penta-2,4-diene-1,4-diol (CID 87933185) is (2E)-penta-2,4-diene-1,4-diol.
What is the SMILES notation for (2E)-penta-2,4-diene-1,4-diol?
The canonical SMILES for (2E)-penta-2,4-diene-1,4-diol is C=C(O)/C=C/CO.
What is the InChIKey of (2E)-penta-2,4-diene-1,4-diol?
The InChIKey is OMNUJUJYJXOIRM-NSCUHMNNSA-N. The full InChI is InChI=1S/C5H8O2/c1-5(7)3-2-4-6/h2-3,6-7H,1,4H2/b3-2+.
What are the key properties of (2E)-penta-2,4-diene-1,4-diol?
(2E)-penta-2,4-diene-1,4-diol has a molecular weight of 100.12 g/mol, XLogP of 0.61, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-penta-2,4-diene-1,4-diol is sourced from PubChem (CID 87933185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).