C16H30N2O3 — CID 142099574
methanamine;4-[(3E,5Z)-7-(2-methoxyethoxy)hepta-1,3,5-trien-4-yl]piperidin-4-ol (PubChem CID 142099574) has the molecular formula C16H30N2O3 and a molecular weight of 298.43 g/mol. Its IUPAC name is methanamine;4-[(3E,5Z)-7-(2-methoxyethoxy)hepta-1,3,5-trien-4-yl]piperidin-4-ol.
| Compound Name | methanamine;4-[(3E,5Z)-7-(2-methoxyethoxy)hepta-1,3,5-trien-4-yl]piperidin-4-ol |
|---|---|
| PubChem CID | 142099574 |
| Molecular Formula | C16H30N2O3 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | methanamine;4-[(3E,5Z)-7-(2-methoxyethoxy)hepta-1,3,5-trien-4-yl]piperidin-4-ol |
| SMILES | C=C/C=C(\C=C/COCCOC)C1(O)CCNCC1.CN |
| InChI | InChI=1S/C15H25NO3.CH5N/c1-3-5-14(6-4-11-19-13-12-18-2)15(17)7-9-16-10-8-15;1-2/h3-6,16-17H,1,7-13H2,2H3;2H2,1H3/b6-4-,14-5+; |
| InChIKey | VCJMLUCZZIHNPJ-PUFLIBLQSA-N |
| XLogP | 1.01 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|